3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione structure
|
Common Name | 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 106932-37-0 | Molecular Weight | 270.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione |
|---|
| Molecular Formula | C17H18O3 |
|---|---|
| Molecular Weight | 270.32300 |
| Exact Mass | 270.12600 |
| PSA | 54.37000 |
| LogP | 3.85760 |
| InChIKey | YYCUBWQCPSYKJC-UHFFFAOYSA-N |
| SMILES | CCCCCC=CC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
3-hept-1-enyl-4... CAS#:106932-37-0 |
| Literature: Hooker Journal of the American Chemical Society, 1936 , vol. 58, p. 1174,1178 |
|
~%
3-hept-1-enyl-4... CAS#:106932-37-0 |
| Literature: Hooker Journal of the American Chemical Society, 1936 , vol. 58, p. 1174,1178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |