3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione
3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione structure
|
Common Name | 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 106932-37-0 | Molecular Weight | 270.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Hept-1-enyl-4-hydroxynaphthalene-1,2-dione (CAS number: 106932-37-0), with molecular formula C17H18O3 and molecular weight 270.32300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18O3 |
|---|---|
| Molecular Weight | 270.32300 |
| Exact Mass | 270.12600 |
| PSA | 54.37000 |
| LogP | 3.85760 |
| InChIKey | YYCUBWQCPSYKJC-UHFFFAOYSA-N |
| SMILES | CCCCCC=CC1=C(O)c2ccccc2C(=O)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-hept-1-enyl-4... CAS#:106932-37-0 |
| Literature: Hooker Journal of the American Chemical Society, 1936 , vol. 58, p. 1174,1178 |
|
~%
3-hept-1-enyl-4... CAS#:106932-37-0 |
| Literature: Hooker Journal of the American Chemical Society, 1936 , vol. 58, p. 1174,1178 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: Molecular formula of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is C17H18O3. |
| Q: What is the LogP of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: LogP of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is 3.85760. |
| Q: What are the upstream materials of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: Related upstream materials(CAS) of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione: 483-55-6;111-71-7;83-72-7. |
| Q: What is the InChIKey of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: InChIKey of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is YYCUBWQCPSYKJC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: Molecular weight of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is 270.32300. |
| Q: What is the polar surface area (PSA) of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: Polar surface area (PSA) of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is 54.37000. |
| Q: What is the CAS number of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: CAS number of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is 106932-37-0. |
| Q: What is the English name of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: The English name of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione. |
| Q: What is the Chinese name of 106932-37-0? |
| A: Chinese name of 106932-37-0 is 106932-37-0. |
| Q: What is the SMILES notation of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione? |
| A: SMILES notation of 3-hept-1-enyl-4-hydroxynaphthalene-1,2-dione is CCCCCC=CC1=C(O)c2ccccc2C(=O)C1=O. |