4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol structure
|
Common Name | 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 106948-07-6 | Molecular Weight | 260.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol |
|---|
| Molecular Formula | C11H16O5S |
|---|---|
| Molecular Weight | 260.30700 |
| Exact Mass | 260.07200 |
| PSA | 95.51000 |
| LogP | 2.09010 |
| InChIKey | RQPIVDPQYYCSFB-UHFFFAOYSA-N |
| SMILES | CC1(CO)CO1.Cc1ccc(S(=O)(=O)O)cc1 |
|
~%
4-methylbenzene... CAS#:106948-07-6 |
| Literature: Journal of the American Chemical Society, , vol. 109, # 19 p. 5765 - 5780 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |