4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol
4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol structure
|
Common Name | 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 106948-07-6 | Molecular Weight | 260.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Methylbenzenesulfonic acid, (2-methyloxiran-2-yl)methanol, CAS number: 106948-07-6, molecular formula: C11H16O5S, molecular weight: 260.30700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16O5S |
|---|---|
| Molecular Weight | 260.30700 |
| Exact Mass | 260.07200 |
| PSA | 95.51000 |
| LogP | 2.09010 |
| InChIKey | RQPIVDPQYYCSFB-UHFFFAOYSA-N |
| SMILES | CC1(CO)CO1.Cc1ccc(S(=O)(=O)O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-methylbenzene... CAS#:106948-07-6
Learn More
|
| Literature: Journal of the American Chemical Society, , vol. 109, # 19 p. 5765 - 5780 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: CAS number of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is 106948-07-6. |
| Q: What is the Chinese name of 106948-07-6? |
| A: Chinese name of 106948-07-6 is 106948-07-6. |
| Q: What is the InChIKey of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: InChIKey of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is RQPIVDPQYYCSFB-UHFFFAOYSA-N. |
| Q: What is the English name of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: The English name of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol. |
| Q: What is the polar surface area (PSA) of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: Polar surface area (PSA) of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is 95.51000. |
| Q: What are the upstream materials of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: Related upstream materials(CAS) of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol: 98-59-9. |
| Q: What is the SMILES notation of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: SMILES notation of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is CC1(CO)CO1.Cc1ccc(S(=O)(=O)O)cc1. |
| Q: What is the LogP of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: LogP of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is 2.09010. |
| Q: What is the molecular weight of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: Molecular weight of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is 260.30700. |
| Q: What is the molecular formula of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol? |
| A: Molecular formula of 4-methylbenzenesulfonic acid,(2-methyloxiran-2-yl)methanol is C11H16O5S. |