1-Allyl-N,N-diisopropyl-1,1-dimethylsilanamine structure
|
Common Name | 1-Allyl-N,N-diisopropyl-1,1-dimethylsilanamine | ||
|---|---|---|---|---|
| CAS Number | 106948-24-7 | Molecular Weight | 199.408 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 204.4±19.0 °C at 760 mmHg | |
| Molecular Formula | C11H25NSi | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 77.4±21.5 °C | |
| Name | N-[dimethyl(prop-2-enyl)silyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 204.4±19.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C11H25NSi |
| Molecular Weight | 199.408 |
| Flash Point | 77.4±21.5 °C |
| Exact Mass | 199.175629 |
| PSA | 3.24000 |
| LogP | 3.54 |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | GSTVYECJWYQBKF-UHFFFAOYSA-N |
| SMILES | C=CC[Si](C)(C)N(C(C)C)C(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39-36/37 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00191711 |
| ALLYLDIMETHYL(DIISOPROPYLAMINO)SILANE |
| Silanamine,1,1-dimethyl-N,N-bis(1-methylethyl)-1-(2-propen-1-yl) |
| 1-Allyl-N,N-diisopropyl-1,1-dimethylsilanamine |
| Silanamine, 1,1-dimethyl-N,N-bis(1-methylethyl)-1-(2-propen-1-yl)- |
| (allyl)(diisopropylamino)dimethylsilane |