Tetradecamethylhexasiloxane
Modify Date: 2026-07-11 15:52:35
Tetradecamethylhexasiloxane structure
|
Common Name | Tetradecamethylhexasiloxane | ||
|---|---|---|---|---|
| CAS Number | 107-52-8 | Molecular Weight | 458.993 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 245.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H42O5Si6 | Melting Point | -59ºC | |
| MSDS | N/A | Flash Point | 144.1±23.6 °C | |
| Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.5±0.0 °C at 760 mmHg |
| Melting Point | -59ºC |
| Molecular Formula | C14H42O5Si6 |
| Molecular Weight | 458.993 |
| Flash Point | 144.1±23.6 °C |
| Exact Mass | 458.164795 |
| PSA | 46.15000 |
| LogP | 10.09 |
| Appearance of Characters | liquid |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.420 |
| InChIKey | ADANNTOYRVPQLJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| Storage condition | 2~8°C |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Tetradecamethylhexasiloxan |
| EINECS 203-499-5 |
| UNII-2Z34S42KA0 |
| Hexasiloxane,tetradecamethyl |
| tetradecamethyl-hexasiloxane |
| Tetrameres Dimethylsiloxan |
| tetradecamethylpentasiloxane |
| Tetradecamethylhexasiloxane |
| 2Z34S42KA0 |
| dodecamethylpentasiloxane |
| Tetradecamethyl Hexasiloxane |