VM4-037 structure
|
Common Name | VM4-037 | ||
|---|---|---|---|---|
| CAS Number | 1071470-72-8 | Molecular Weight | 620.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29FN6O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VM4-037VM4-037 can be used for the synthesis of VM4-037(18F). VM4-037(18F) is a fluorinated PET imaging agent for carbonic anhydrase IX[1]. |
| Name | VM4-037 |
|---|
| Description | VM4-037 can be used for the synthesis of VM4-037(18F). VM4-037(18F) is a fluorinated PET imaging agent for carbonic anhydrase IX[1]. |
|---|---|
| Related Catalog | |
| Target |
CA Ⅸ |
| Molecular Formula | C26H29FN6O7S2 |
|---|---|
| Molecular Weight | 620.67 |
| InChIKey | QGYZPMXIVNIGKA-GMAHTHKFSA-N |
| SMILES | CC(C)C(C(=O)NC(Cc1ccc(OCCF)cc1)C(=O)O)n1cc(COc2ccc3nc(S(N)(=O)=O)sc3c2)nn1 |