1-Fluoropyridinium tetrafluoroborate structure
|
Common Name | 1-Fluoropyridinium tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 107264-09-5 | Molecular Weight | 184.903 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H5BF5N | Melting Point | 186-192 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1-fluoropyridinium tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 186-192 °C(lit.) |
|---|---|
| Molecular Formula | C5H5BF5N |
| Molecular Weight | 184.903 |
| Exact Mass | 185.043518 |
| PSA | 3.88000 |
| LogP | 2.00670 |
| InChIKey | PIGQKECRKGMXRG-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.F[n+]1ccccc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~77%
1-Fluoropyridin... CAS#:107264-09-5 |
| Literature: Umemoto, Teruo; Harasawa, Kikuko; Tomizawa, Ginjiro; Kawada, Kosuke; Tomita, Kyoichi Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 4 p. 1081 - 1092 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Electrochemical studies of six N? F electrophilic fluorinating reagents. Oliver EW and Evans DH.
J. Electroanal. Chem. 474(1) , 1-8, (1999)
|
|
|
Relative electrophilic fluorinating power as assayed by competitive catalytic halogenation reactions. Toullec PY, et al.
Helv. Chim. Acta 87(10) , 2706-11, (2004)
|
| N-Fluoropyridinium tetrafluoroborate |
| 1-Fluoropyridinium tetrafluoroborate |
| 1-fluoropyridin-1-ium,tetrafluoroborate |
| MFCD00153176 |