N-[2-(S)-Methyl-d3-butyryl]-4-(S)-phenylmethyl-2-oxazolidinone structure
|
Common Name | N-[2-(S)-Methyl-d3-butyryl]-4-(S)-phenylmethyl-2-oxazolidinone | ||
|---|---|---|---|---|
| CAS Number | 1073232-99-1 | Molecular Weight | 264.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16D3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(S)-Methyl-d3-butyryl]-4-(S)-phenylmethyl-2-oxazolidinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16D3NO3 |
|---|---|
| Molecular Weight | 264.33500 |
| Exact Mass | 264.15500 |
| PSA | 46.61000 |
| LogP | 2.56050 |
| InChIKey | IDJHFWFQTXWYQU-BMSJAHLVSA-N |
| SMILES | CCC(C)C(=O)N1C(=O)OCC1Cc1ccccc1 |
|
~77%
N-[2-(S)-Methyl... CAS#:1073232-99-1 |
| Literature: Neumann, Christopher S.; Walsh, Christopher T. Journal of the American Chemical Society, 2008 , vol. 130, # 43 p. 14022 - 14023 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Benzyl-3-[2-(<sup>2</sup>H<sub>3</sub>)methylbutanoyl]-1,3-oxazolidin-2-one |