Lintopride structure
|
Common Name | Lintopride | ||
|---|---|---|---|---|
| CAS Number | 107429-63-0 | Molecular Weight | 310.77900 | |
| Density | 1.35g/cm3 | Boiling Point | 494.1ºC at 760 mmHg | |
| Molecular Formula | C14H19ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
Use of LintoprideLintopride is a 5HT4 antagonist with moderate 5HT3 antagonist properties. |
| Name | 4-amino-5-chloro-N-[(1-ethyl-4,5-dihydroimidazol-2-yl)methyl]-2-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Lintopride is a 5HT4 antagonist with moderate 5HT3 antagonist properties. |
|---|---|
| Related Catalog | |
| Target |
5HT4[1] |
| In Vitro | Lintopride significantly increases the lower oesophageal sphincter basal tone without affecting lower oesophageal sphincter physiological relaxation after swallowing. Peristaltic waves are also enhanced by Lintopride[1]. |
| References |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 494.1ºC at 760 mmHg |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.77900 |
| Flash Point | 252.6ºC |
| Exact Mass | 310.12000 |
| PSA | 83.44000 |
| LogP | 1.92410 |
| Vapour Pressure | 6.62E-10mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | MJCKISCWHDATBN-UHFFFAOYSA-N |
| SMILES | CCN1CCN=C1CNC(=O)c1cc(Cl)c(N)cc1OC |
| Storage condition | 2-8℃ |
| UNII-C2R0GEU722 |
| Lintopridum [INN-Latin] |
| Lintoprida [INN-Spanish] |
| Lintopridum |
| Lintoprida |
| Lintopride |