4-[(Pyridin-4-yl)Methyl]-2H-phthalazin-1-one structure
|
Common Name | 4-[(Pyridin-4-yl)Methyl]-2H-phthalazin-1-one | ||
|---|---|---|---|---|
| CAS Number | 107558-48-5 | Molecular Weight | 237.257 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 538.4ºC at 760mmHg | |
| Molecular Formula | C14H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.4ºC | |
| Name | 4-(pyridin-4-ylmethyl)-2H-phthalazin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.4ºC at 760mmHg |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.257 |
| Flash Point | 279.4ºC |
| Exact Mass | 237.090210 |
| PSA | 58.64000 |
| LogP | 1.00 |
| Vapour Pressure | 3.32E-12mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | NIQMWTLRDNQDIA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(Cc2ccncc2)c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~81%
4-[(Pyridin-4-y... CAS#:107558-48-5 |
| Literature: Bold, Guido; Altmann, Karl-Heinz; Frei, Joerg; Lang, Marc; Manley, Paul W.; Traxler, Peter; Wietfeld, Bernhard; Brueggen, Josef; Buchdunger, Elisabeth; Cozens, Robert; Ferrari, Stefano; Furet, Pascal; Hofmann, Francesco; Martiny-Baron, Georg; Mestan, Juergen; Roesel, Johannes; Sills, Matthew; Stover, David; Acemoglu, Figan; Boss, Eugen; Emmenegger, Rene; Laesser, Laurent; Masso, Elvira; Roth, Rosemarie; Schlachter, Christian; Vetterli, Werner; Wyss, Dominique; Wood, Jeanette M. Journal of Medicinal Chemistry, 2000 , vol. 43, # 12 p. 2310 - 2323 |
|
~%
4-[(Pyridin-4-y... CAS#:107558-48-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 43, # 12 p. 2310 - 2323 |
|
~%
4-[(Pyridin-4-y... CAS#:107558-48-5 |
| Literature: Chinese Chemical Letters, , vol. 21, # 9 p. 1071 - 1074 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1(2H)-Phthalazinone, 4-(4-pyridinylmethyl)- |
| 4-(pyridin-4-ylmethyl)phthalazin-1(2H)-one |
| 4-(4-Pyridinylmethyl)-1(2H)-phthalazinone |
| 4-(Pyridin-4-ylmethyl)phthalazin-1(2H)-on |
| 4-(pyridin-4-ylmethyl)-1(2H)-phthalazinone |
| 5-(pyridin-4-yl)methyl-2H-phthalazin-1-one |
| 4-[(Pyridin-4-yl)methyl]-2H-phthalazin-1-one |
| 4-(4-pyridylmethyl)-1(2H)-phthalazinone |