Ethyl brevifolincarboxylate structure
|
Common Name | Ethyl brevifolincarboxylate | ||
|---|---|---|---|---|
| CAS Number | 107646-82-2 | Molecular Weight | 320.25100 | |
| Density | 1.7g/cm3 | Boiling Point | 629.6ºC at 760mmHg | |
| Molecular Formula | C15H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
Use of Ethyl brevifolincarboxylateEthyl brevifolincarboxylate (compound 3) can be isolated from Quercus wutaishanica seeds[1]. |
| Name | ethyl 7,8,9-trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Ethyl brevifolincarboxylate (compound 3) can be isolated from Quercus wutaishanica seeds[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 629.6ºC at 760mmHg |
| Molecular Formula | C15H12O8 |
| Molecular Weight | 320.25100 |
| Flash Point | 240.5ºC |
| Exact Mass | 320.05300 |
| PSA | 134.27000 |
| LogP | 1.14290 |
| Vapour Pressure | 1.92E-16mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | JSEPSLOCPQODTM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(=O)c2oc(=O)c3cc(O)c(O)c(O)c3c21 |
| EBFC |
| ethylbrevifolin carboxylate |