bis(2,4,4-trimethylpentyl)dithiophosphinic acid
Modify Date: 2025-08-25 23:05:31
bis(2,4,4-trimethylpentyl)dithiophosphinic acid structure
|
Common Name | bis(2,4,4-trimethylpentyl)dithiophosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 107667-02-7 | Molecular Weight | 322.55300 | |
| Density | 0.949g/cm3 | Boiling Point | 371.3ºC at 760mmHg | |
| Molecular Formula | C16H35PS2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 178.3ºC | |
| Symbol |
GHS02, GHS05, GHS06, GHS09 |
Signal Word | Danger | |
| Name | sulfanyl-sulfanylidene-bis(2,4,4-trimethylpentyl)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949g/cm3 |
|---|---|
| Boiling Point | 371.3ºC at 760mmHg |
| Molecular Formula | C16H35PS2 |
| Molecular Weight | 322.55300 |
| Flash Point | 178.3ºC |
| Exact Mass | 322.19200 |
| PSA | 80.70000 |
| LogP | 7.10590 |
| Vapour Pressure | 2.23E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.507 |
| InChIKey | YOCZZJWFWDUAAR-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)C)CP(=S)(S)CC(C)CC(C)(C)C |
| Symbol |
GHS02, GHS05, GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H302-H314-H331-H411 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+: Very toxic;C: Corrosive; |
| Risk Phrases | 10-22-26-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3390 6.1/PG 1 |
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~%
bis(2,4,4-trime... CAS#:107667-02-7 |
| Literature: Liu, Leo Zhaoqing; Woodward, Gary Patent: US2008/103330 A1, 2008 ; Location in patent: Page/Page column 7 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Highly efficient and selective transport of methylene blue through a bulk liquid membrane containing Cyanex 301 as carrier. Madaeni SS, et al.
Separ. Purif. Tech. 81(2) , 116-23, (2011)
|
|
|
Highly efficient and selective transport of Hg2+ ions through a bulk liquid membrane containing Cyanex 301 as carrier. Madaeni SS, et al.
Asia-Pac. J. Chem. Eng. 6(4) , 631-38, (2011)
|
|
|
Selective transport of bismuth ions through supported liquid membrane. Madaeni SS and Karami Zand HR.
Chem. Eng. Tech. 28(8) , 892, (2005)
|
| Bis(2,4,4-trimethylpentyl)dithiophosphinic acid |
| di(2,4,4-trimethylpentyl)dithiophosphinic acid |
| Diisooctyldithiophosphinic acid |
| Phosphinodithioic acid,P,P-bis(2,4,4-trimethylpentyl) |
| bis(2,4,4-trimethylpentyl)dithiophosphonic acid |