Quinovin structure
|
Common Name | Quinovin | ||
|---|---|---|---|---|
| CAS Number | 107870-05-3 | Molecular Weight | 632.82 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 753.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H56O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5±26.4 °C | |
Use of QuinovinQuinovic acid 3-O-β-D-quinovopyranoside is a tritenpenoid glycoside, that can be isolated from the bark of L. hexandra[1]. |
| Name | Quinovin |
|---|---|
| Synonym | More Synonyms |
| Description | Quinovic acid 3-O-β-D-quinovopyranoside is a tritenpenoid glycoside, that can be isolated from the bark of L. hexandra[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 753.3±60.0 °C at 760 mmHg |
| Molecular Formula | C36H56O9 |
| Molecular Weight | 632.82 |
| Flash Point | 229.5±26.4 °C |
| Exact Mass | 632.392456 |
| PSA | 153.75000 |
| LogP | 8.17 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | PUOQHFWXBKTHST-DLCGLXBKSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C(=O)O)C(=CCC4C5(C)CCC(OC6OC(C)C(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1C |
| Storage condition | ?20°C |
| Hazard Codes | Xi |
|---|
| Quinovic acid β-D-glucoside |
| 3-O-β-D-quinovopyranosyl quinovic acid |
| (3β)-3-[(6-Deoxy-β-D-glucopyranosyl)oxy]urs-12-ene-27,28-dioic acid |
| Urs-12-ene-27,28-dioic acid, 3-[(6-deoxy-β-D-glucopyranosyl)oxy]-, (3β)- |