5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate structure
|
Common Name | 5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 108049-92-9 | Molecular Weight | 280.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10NO7 |
|---|---|
| Molecular Weight | 280.21000 |
| Exact Mass | 280.04600 |
| PSA | 129.32000 |
| LogP | 0.26040 |
| InChIKey | RICUAYWXAIQBNW-UHFFFAOYSA-M |
| SMILES | O=C([O-])CCC(=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
|
~91%
5-[(4-nitrophen... CAS#:108049-92-9 |
| Literature: Natsugari, Hideaki; Kawano, Yasuhiko; Morimoto, Akira; Yoshioka, Kouichi; Ochiai, Michihiko Journal of the Chemical Society, Chemical Communications, 1987 , # 2 p. 62 - 63 |
|
~%
5-[(4-nitrophen... CAS#:108049-92-9 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US4891427 A1, 1990 ; |
|
~%
5-[(4-nitrophen... CAS#:108049-92-9 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US4882434 A1, 1989 ; |
| 2-oxo-glutaric acid 1-p-nitrobenzyl ester |