4-nitrobenzylbromide structure
|
Common Name | 4-nitrobenzylbromide | ||
|---|---|---|---|---|
| CAS Number | 100-11-8 | Molecular Weight | 216.032 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 304.2±17.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrNO2 | Melting Point | 98 °C | |
| MSDS | Chinese USA | Flash Point | 137.8±20.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-nitrobenzyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.2±17.0 °C at 760 mmHg |
| Melting Point | 98 °C |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Flash Point | 137.8±20.9 °C |
| Exact Mass | 214.958176 |
| PSA | 45.82000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | VOLRSQPSJGXRNJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)cc1 |
| Stability | Stable. Incomaptible with bases, amines, oxidizing agents, alcohols. May be moisture sensitive. Corrodes steel. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS7967000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29049085 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
A case of multiple sensitization to three halogeno-substituted mono-nitrobenzenes.
Ital. Gen. Rev. Dermatol. 15(2) , 107-12, (1978) A case of occupational contact dermatitis in a female chemical pharmaceutical laboratory researcher is described. The allergological investigation revealed a state of sensitization to three mono-nitro... |
|
|
Synthesis of p, p'-divinylazobenzene.
Di Yi Jun Yi Da Xue Xue Bao 23(3) , 273-6, (2003) To synthesize p, p'-divinylazobenzene (DVAB).Wittig reagent was initially synthesized using P-nitrobenzyl bromide and triphenylphosphine, followed by reaction with formaldehyde to produce p-nitro styr... |
|
|
Allergic contact dermatitis from para-nitrobenzyl bromide.
Contact Dermatitis 38(4) , 232, (1998)
|
| α-Bromoparanitrotoluene |
| 1-(Bromomethyl)-4-nitrobenzene |
| Benzene, 1- (bromomethyl)-4-nitro- |
| Toluene, α-bromo-4-nitro- |
| α-Bromo-4-nitrotoluene |
| α-Bromo-p-nitrotoluene |
| 4-nitrobenzylbromide |
| MFCD00007373 |
| EINECS 202-820-6 |
| Benzene, 1-(bromomethyl)-4-nitro- |
| Toluene, α-bromo-p-nitro- |
| 4-Nitrobenzyl bromide |