CYTOCHALASINO structure
|
Common Name | CYTOCHALASINO | ||
|---|---|---|---|---|
| CAS Number | 108050-26-6 | Molecular Weight | 451.59800 | |
| Density | 1.21g/cm3 | Boiling Point | 681.8ºC at 760mmHg | |
| Molecular Formula | C28H37NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 366.1ºC | |
Use of CYTOCHALASINOCytochalasin O (compound 13) is a secondary metabolite of the phytopathogenic fungus P. sp. CIB-109[1]. |
| Name | Cytochalasin Opho |
|---|
| Description | Cytochalasin O (compound 13) is a secondary metabolite of the phytopathogenic fungus P. sp. CIB-109[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 681.8ºC at 760mmHg |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.59800 |
| Flash Point | 366.1ºC |
| Exact Mass | 451.27200 |
| PSA | 93.28000 |
| LogP | 3.58730 |
| Vapour Pressure | 1.6E-19mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | UMHVFKLUODBPSC-KRQHZRJMSA-N |
| SMILES | CC1=C(C)C2C(Cc3ccccc3)NC(=O)C23C(O)C=CC(C)(O)CC(C)CC=CC3C1O |
|
~%
CYTOCHALASINO CAS#:108050-26-6 |
| Literature: Tomioka; Izawa; Koyama; Natori Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 2 p. 902 - 905 |
|
~%
CYTOCHALASINO CAS#:108050-26-6 |
| Literature: Izawa; Hirose; Shimizu; Koyama; Natori Tetrahedron, 1989 , vol. 45, # 8 p. 2323 - 2335 |
|
~%
CYTOCHALASINO CAS#:108050-26-6 |
| Literature: Izawa; Hirose; Shimizu; Koyama; Natori Tetrahedron, 1989 , vol. 45, # 8 p. 2323 - 2335 |
|
~%
CYTOCHALASINO CAS#:108050-26-6 |
| Literature: Izawa; Hirose; Shimizu; Koyama; Natori Tetrahedron, 1989 , vol. 45, # 8 p. 2323 - 2335 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |