CYTOCHALASINN structure
|
Common Name | CYTOCHALASINN | ||
|---|---|---|---|---|
| CAS Number | 108050-28-8 | Molecular Weight | 493.63 | |
| Density | 1.2g/cm3 | Boiling Point | 678.6ºC at 760mmHg | |
| Molecular Formula | C30H39NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.2ºC | |
Use of CYTOCHALASINNCytochalasin N is a cytorelaxin derived from endophytic fungus Phomopsis sp.CIB-109[1]. |
| Name | Cytochalasin Npho |
|---|
| Description | Cytochalasin N is a cytorelaxin derived from endophytic fungus Phomopsis sp.CIB-109[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 678.6ºC at 760mmHg |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.63 |
| Flash Point | 364.2ºC |
| Exact Mass | 493.28300 |
| PSA | 99.35000 |
| LogP | 4.15810 |
| Vapour Pressure | 2.42E-19mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | WFSYATBEJTUDQA-BBXOWAOSSA-N |
| SMILES | CC(=O)OC1C=CC(C)(O)CC(C)CC=CC2C(O)C(C)=C(C)C3C(Cc4ccccc4)NC(=O)C123 |
|
~%
CYTOCHALASINN CAS#:108050-28-8 |
| Literature: Tomioka; Izawa; Koyama; Natori Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 2 p. 902 - 905 |
|
~%
CYTOCHALASINN CAS#:108050-28-8 |
| Literature: Izawa; Hirose; Shimizu; Koyama; Natori Tetrahedron, 1989 , vol. 45, # 8 p. 2323 - 2335 |
|
~0%
CYTOCHALASINN CAS#:108050-28-8 |
| Literature: Tomioka; Izawa; Koyama; Natori Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 2 p. 902 - 905 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |