CYTOCHALASINP structure
|
Common Name | CYTOCHALASINP | ||
|---|---|---|---|---|
| CAS Number | 108050-27-7 | Molecular Weight | 511.65000 | |
| Density | 1.23g/cm3 | Boiling Point | 678.9ºC at 760mmHg | |
| Molecular Formula | C30H41NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cytochalasin Ppho |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 678.9ºC at 760mmHg |
| Molecular Formula | C30H41NO6 |
| Molecular Weight | 511.65000 |
| Exact Mass | 511.29300 |
| PSA | 119.58000 |
| LogP | 3.20880 |
| Vapour Pressure | 2.34E-19mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | AVASIWUXPVFFGK-WRERFMELSA-N |
| SMILES | CC(=O)OC1C=CC(C)(O)CC(C)CC=CC2C(O)C(C)(O)C(C)C3C(Cc4ccccc4)NC(=O)C123 |
|
~29%
CYTOCHALASINP CAS#:108050-27-7 |
| Literature: Tomioka; Izawa; Koyama; Natori Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 2 p. 902 - 905 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |