Ethyl 5-bromo-1H-indazole-3-carboxylate structure
|
Common Name | Ethyl 5-bromo-1H-indazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1081-04-5 | Molecular Weight | 269.095 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 406.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.6±23.2 °C | |
| Name | Ethyl 5-bromo-1H-indazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.4±25.0 °C at 760 mmHg |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.095 |
| Flash Point | 199.6±23.2 °C |
| Exact Mass | 267.984741 |
| PSA | 54.98000 |
| LogP | 2.90 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | DKVWLGFTRAWGAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1n[nH]c2ccc(Br)cc12 |
| HS Code | 2933990090 |
|---|
|
~%
Ethyl 5-bromo-1... CAS#:1081-04-5 |
| Literature: Chemische Berichte, , vol. 55, p. 1141,1157 |
|
~%
Ethyl 5-bromo-1... CAS#:1081-04-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 56, # 15 p. 6259 - 6272 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-3-carboxylic acid, 5-bromo-, ethyl ester |
| Ethyl 5-bromo-1H-indazole-3-carboxylate |