Formaldehyde,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Formaldehyde,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1081-15-8 | Molecular Weight | 210.14700 | |
| Density | 1.54g/cm3 | Boiling Point | 357.8ºC at 760mmHg | |
| Molecular Formula | C7H6N4O4 | Melting Point | 153-156ºC | |
| MSDS | Chinese USA | Flash Point | 170.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Formaldehyde-DNPH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 357.8ºC at 760mmHg |
| Melting Point | 153-156ºC |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.14700 |
| Flash Point | 170.2ºC |
| Exact Mass | 210.03900 |
| PSA | 116.03000 |
| LogP | 2.64990 |
| Vapour Pressure | 2.67E-05mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | UEQLSLWCHGLSML-UHFFFAOYSA-N |
| SMILES | C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Storage condition | 0-6°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Phrases | 36/37/38-36-20/21/22-11-22 |
| Safety Phrases | 26-36/37/39-36-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| RTECS | AB2826500 |
| Hazard Class | 4.1 |
| HS Code | 2928000090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
A novel miniaturized extraction capillary for determining gaseous formaldehyde by high-performance liquid chromatography.
Anal. Bioanal. Chem 407(3) , 899-905, (2015) A novel miniaturized sample extraction capillary was developed to provide a simple and sensitive method for analyzing gaseous formaldehyde (FA) using conventional high-performance liquid chromatograph... |
|
|
Determination of formaldehyde in hair creams by gas chromatography-mass spectrometry.
Drug Test. Anal. 7 , 848-52, (2015)
|
|
|
Direct transcriptional control of a p38 MAPK pathway by the circadian clock in Neurospora crassa.
PLoS ONE 6 , e27149, (2011) MAPK signal transduction pathways are important regulators of stress responses, cellular growth, and differentiation. In Neurospora, the circadian clock controls rhythms in phosphorylation of the p38-... |
| Formaldehyde-2,4-DNPH |
| Formaldehyde-2,4-dinitrophenylhydrazone |
| N-(methylideneamino)-2,4-dinitroaniline |
| MFCD00191364 |
| ForMaldehyde 2,4-Dinitrophenylhydrazone |