Bucetin structure
|
Common Name | Bucetin | ||
|---|---|---|---|---|
| CAS Number | 1083-57-4 | Molecular Weight | 223.26800 | |
| Density | 1.151g/cm3 | Boiling Point | 433.5ºC at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | 160ºC | |
| MSDS | Chinese USA | Flash Point | 216ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of BucetinBucetin (3-Hydroxy-p-butyrophenetidide) is an analgesic and antipyretic compound. |
| Name | 3-hydroxy-p-butyrophenetidine |
|---|---|
| Synonym | More Synonyms |
| Description | Bucetin (3-Hydroxy-p-butyrophenetidide) is an analgesic and antipyretic compound. |
|---|---|
| Related Catalog |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760 mmHg |
| Melting Point | 160ºC |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 216ºC |
| Exact Mass | 223.12100 |
| PSA | 58.56000 |
| LogP | 1.86770 |
| Vapour Pressure | 2.77E-08mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | LIAWQASKBFCRNR-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)CC(C)O)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H312-H332-H350 |
| Precautionary Statements | P201-P280-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 45-46-20/21/22 |
| Safety Phrases | 53-22-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | EU0900000 |
| HS Code | 2924299090 |
|
~%
Bucetin CAS#:1083-57-4 |
| Literature: US2830087 , ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Carcinogenicity of bucetin in (C57BL/6 X C3H)F1 mice.
J. Natl. Cancer Inst. 79(5) , 1151-8, (1987) The carcinogenicity of bucetin [(3-hydroxy-p-butyrophenetidide) CAS: 1083-57-4], an antipyretic analgesic drug, was examined in 300 (C57BL/6 X C3H)F1 mice. Groups of 50 mice of each sex were treated w... |
|
|
Mechanism of metabolic activation of the analgetic bucetin to bacterial mutagens by hamster liver microsomes.
Chem. Pharm. Bull. 33(7) , 2877-85, (1985)
|
|
|
[Biopharmaceutical studies of drugs. III. Serum concentration level of o-ethoxybenzamide and N-(beta-hydroxybutyryl)-p-phenetidine after simultaneous administration to rabbit (author's transl)].
Yakugaku Zasshi 101(6) , 556-66, (1981)
|
| N-(4-ethoxyphenyl)-3-hydroxybutanamide |
| N-(3-Hydroxybutyryl)-p-phenetidine |
| 3-Hydroxy-p-butyrophenetidide (N-(4-Ethoxyphenyl)-3-hydroxybutanamide |
| MFCD00021906 |
| 3-Hydroxy-p-butyrophenetidine |
| 4'-Ethoxy-3-hydroxybutyranilide |
| Bucetin |