(S)-ethyl (6,8-difluoro-4-oxochroman-3-yl)carbamate structure
|
Common Name | (S)-ethyl (6,8-difluoro-4-oxochroman-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1083157-18-9 | Molecular Weight | 271.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-ethyl (6,8-difluoro-4-oxochroman-3-yl)carbamate |
|---|
| Molecular Formula | C12H11F2NO4 |
|---|---|
| Molecular Weight | 271.21700 |
| Exact Mass | 271.06600 |
| PSA | 64.63000 |
| LogP | 2.04550 |
| InChIKey | DXKYZPOMIUNPBW-VIFPVBQESA-N |
| SMILES | CCOC(=O)NC1COc2c(F)cc(F)cc2C1=O |
|
~%
(S)-ethyl (6,8-... CAS#:1083157-18-9 |
| Literature: BIAL-PORTELA and CA, S.A. Patent: WO2008/143540 A1, 2008 ; Location in patent: Page/Page column 10-11 ; |
|
~%
(S)-ethyl (6,8-... CAS#:1083157-18-9 |
| Literature: Beliaev, Alexandre; Wahnon, Jorge; Russo, Domenico Organic Process Research and Development, 2012 , vol. 16, # 4 p. 704 - 709 |