Etamicastat structure
|
Common Name | Etamicastat | ||
|---|---|---|---|---|
| CAS Number | 760173-05-5 | Molecular Weight | 311.35 | |
| Density | 1.44 | Boiling Point | 435.308ºC at 760 mmHg | |
| Molecular Formula | C14H15F2N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.067ºC | |
Use of EtamicastatEtamicastat (BIA 5-453) is a potent and reversible peripheral dopamine-β-hydroxylase (DβH) inhibitor[1]. |
| Name | 4-(2-aminoethyl)-3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-1H-imidazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Description | Etamicastat (BIA 5-453) is a potent and reversible peripheral dopamine-β-hydroxylase (DβH) inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
Dopamine-β-hydroxylase (DβH)[1] |
| In Vivo | Upon intraperitoneal administration to NMRi mice, Etamicastat (100 mg/ kg) leads to a significant reduction of noradrenaline levels (36% control) in heart with concomitant increasing in dopamine levels (850% of control)[2]. Etamicastat (50 mg/kg) is rapidly absorbed into the systemic circulation reaching a maximum concentration at 4 h post-administration, representing 29% of total Etamicastat and quantified metabolites, using AUC0-t as a measure of systemic exposure[2]. |
| References |
| Density | 1.44 |
|---|---|
| Boiling Point | 435.308ºC at 760 mmHg |
| Molecular Formula | C14H15F2N3OS |
| Molecular Weight | 311.35 |
| Flash Point | 217.067ºC |
| Exact Mass | 311.09000 |
| PSA | 91.87000 |
| LogP | 2.82770 |
| InChIKey | CWWWTTYMUOYSQA-LLVKDONJSA-N |
| SMILES | NCCc1c[nH]c(=S)n1C1COc2c(F)cc(F)cc2C1 |
| Precursor 8 | |
|---|---|
| DownStream 0 | |
| UNII-9X96V6DBU4 |
| Etamitat |