Suc-Ala-Ala-Val-Ala-pNA structure
|
Common Name | Suc-Ala-Ala-Val-Ala-pNA | ||
|---|---|---|---|---|
| CAS Number | 108322-03-8 | Molecular Weight | 550.56200 | |
| Density | 1.314g/cm3 | Boiling Point | 1006.3ºC at 760 mmHg | |
| Molecular Formula | C24H34N6O9 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 562.4ºC | |
| Name | N-Succinyl-Ala-Ala-Val-Ala p-nitroanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 1006.3ºC at 760 mmHg |
| Molecular Formula | C24H34N6O9 |
| Molecular Weight | 550.56200 |
| Flash Point | 562.4ºC |
| Exact Mass | 550.23900 |
| PSA | 242.58000 |
| LogP | 4.01040 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | IYHHIHIBYVIDMJ-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CCC(=O)O)C(=O)NC(C)C(=O)NC(C(=O)NC(C)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 4-[[1-[[1-[[3-methyl-1-[[1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| MFCD00133618 |
| Suc-Ala-Ala-Val-Ala-pNA |