Suc-Ala-Ala-Pro-Ala-pNA structure
|
Common Name | Suc-Ala-Ala-Pro-Ala-pNA | ||
|---|---|---|---|---|
| CAS Number | 72682-69-0 | Molecular Weight | 548.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Suc-Ala-Ala-Pro-Ala-pNASuc-AAPA-pNA is a substrate of chymotrypsin Aα. Suc-AAPA-pNA can be used to test chymotrypsin Aα activity[1]. |
| Name | succinyl-Ala-Ala-Pro-Ala-p-nitroanilide |
|---|---|
| Synonym | More Synonyms |
| Description | Suc-AAPA-pNA is a substrate of chymotrypsin Aα. Suc-AAPA-pNA can be used to test chymotrypsin Aα activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H32N6O9 |
|---|---|
| Molecular Weight | 548.55 |
| Exact Mass | 548.22300 |
| PSA | 219.83000 |
| LogP | 1.61000 |
| InChIKey | DKQHAQUESIKHGC-XSWJXKHESA-N |
| SMILES | CC(NC(=O)CCC(=O)O)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Suc-AAPA-pNA |
| SUC-ALA-ALA-PRO-ALA-PNA |