tert-Butyl [3-(aminomethyl)benzyl]carbamate structure
|
Common Name | tert-Butyl [3-(aminomethyl)benzyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 108467-99-8 | Molecular Weight | 236.310 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 383.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H20N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 185.6±24.6 °C | |
| Name | tert-butyl n-[3-(aminomethyl)benzyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.3±30.0 °C at 760 mmHg |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.310 |
| Flash Point | 185.6±24.6 °C |
| Exact Mass | 236.152481 |
| PSA | 64.35000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | GQAUPTTUSSLXPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CN)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01317800 |
| 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate |
| tert-Butyl [3-(aminomethyl)benzyl]carbamate |
| tert-Butyl 3-(aminomethyl)benzylcarbamate |
| tert-butyl N-[[3-(aminomethyl)phenyl]methyl]carbamate |
| Carbamic acid, N-[[3-(aminomethyl)phenyl]methyl]-, 1,1-dimethylethyl ester |