4-Bromo-2,3-Dimethyl-6-Nitroaniline structure
|
Common Name | 4-Bromo-2,3-Dimethyl-6-Nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 108485-13-8 | Molecular Weight | 245.07300 | |
| Density | 1.609g/cm3 | Boiling Point | 357.9ºC at 760mmHg | |
| Molecular Formula | C8H9BrN2O2 | Melting Point | 152ºC | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | 4-Bromo-2,3-Dimethyl-6-Nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 357.9ºC at 760mmHg |
| Melting Point | 152ºC |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.07300 |
| Flash Point | 170.3ºC |
| Exact Mass | 243.98500 |
| PSA | 71.84000 |
| LogP | 3.66070 |
| Vapour Pressure | 2.64E-05mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | XRYVCCUUPIZPMI-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)cc([N+](=O)[O-])c(N)c1C |
| Risk Phrases | R20/21/22 |
|---|---|
| Safety Phrases | S22-S36/37 |
| RIDADR | 2811 |
| Packaging Group | III |
| HS Code | 2921430090 |
|
~97%
4-Bromo-2,3-Dim... CAS#:108485-13-8 |
| Literature: Grivas, Spiros; Tian, Wei; Ronne, Erik; Lindstroem, Stefan; Olsson, Kjell Acta Chemica Scandinavica, 1993 , vol. 47, # 5 p. 521 - 528 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Bromo-2,3-dimethyl-6-nitroaniline |
| MFCD00051710 |