ZINC ACETYLACETONATE HYDRATE
ZINC ACETYLACETONATE HYDRATE structure
|
Common Name | ZINC ACETYLACETONATE HYDRATE | ||
|---|---|---|---|---|
| CAS Number | 108503-47-5 | Molecular Weight | 263.59600 | |
| Density | N/A | Boiling Point | sublimes [HAW93] | |
| Molecular Formula | C10H14O4Zn | Melting Point | 135-138ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Zinc Acetylacetonate Hydrate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | sublimes [HAW93] |
|---|---|
| Melting Point | 135-138ºC(lit.) |
| Molecular Formula | C10H14O4Zn |
| Molecular Weight | 263.59600 |
| Exact Mass | 262.01800 |
| PSA | 52.60000 |
| LogP | 1.91770 |
| InChIKey | KNXAKZGJNLAYCJ-FDGPNNRMSA-N |
| SMILES | CC(=O)C=C(C)O.CC(=O)C=C(C)O.[Zn] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00149060 |
| EINECS 237-860-3 |
| Zinc acetylacetonate hydrate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Zinc Acetylacetonate Hydrate? |
| A: LogP of Zinc Acetylacetonate Hydrate is 1.91770. |
| Q: What is the English name of Zinc Acetylacetonate Hydrate? |
| A: The English name of Zinc Acetylacetonate Hydrate is Zinc Acetylacetonate Hydrate. |
| Q: What is the CAS number of Zinc Acetylacetonate Hydrate? |
| A: CAS number of Zinc Acetylacetonate Hydrate is 108503-47-5. |
| Q: What is the molecular formula of Zinc Acetylacetonate Hydrate? |
| A: Molecular formula of Zinc Acetylacetonate Hydrate is C10H14O4Zn. |
| Q: What is the molecular weight of Zinc Acetylacetonate Hydrate? |
| A: Molecular weight of Zinc Acetylacetonate Hydrate is 263.59600. |
| Q: What English synonyms does Zinc Acetylacetonate Hydrate have? |
| A: English synonyms of Zinc Acetylacetonate Hydrate: MFCD00149060, EINECS 237-860-3, Zinc acetylacetonate hydrate. |
| Q: What is the safety information for Zinc Acetylacetonate Hydrate? |
| A: Safety information for Zinc Acetylacetonate Hydrate: S26. |
| Q: What is the boiling point of Zinc Acetylacetonate Hydrate? |
| A: Boiling point of Zinc Acetylacetonate Hydrate is sublimes [HAW93]. |
| Q: What is the InChIKey of Zinc Acetylacetonate Hydrate? |
| A: InChIKey of Zinc Acetylacetonate Hydrate is KNXAKZGJNLAYCJ-FDGPNNRMSA-N. |
| Q: What is the polar surface area (PSA) of Zinc Acetylacetonate Hydrate? |
| A: Polar surface area (PSA) of Zinc Acetylacetonate Hydrate is 52.60000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |