Methyl 3-bromo-1H-indazole-5-carboxylate structure
|
Common Name | Methyl 3-bromo-1H-indazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1086391-06-1 | Molecular Weight | 255.068 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 399.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.5±22.3 °C | |
| Name | methyl 3-bromo-2H-indazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.7±22.0 °C at 760 mmHg |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.068 |
| Flash Point | 195.5±22.3 °C |
| Exact Mass | 253.969086 |
| PSA | 54.98000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | JEPZKKWEBQAHAO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2n[nH]c(Br)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
Methyl 3-bromo-... CAS#:1086391-06-1 |
| Literature: WO2013/78237 A1, ; Page/Page column 54 ; |
|
~%
Methyl 3-bromo-... CAS#:1086391-06-1 |
| Literature: WO2013/78237 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 3-bromo-1H-indazole-5-carboxylate |
| METHYL 3-BROMOINDAZOLE-5-CARBOXYLATE |
| SC4424 |
| 1H-Indazole-5-carboxylic acid, 3-bromo-, methyl ester |
| 3-Bromo-4-(1H)indazole carboxylic acid methyl ester |