Methyl-2-deoxyribofuranose 3,5-dibenzoate
Modify Date: 2025-08-26 10:28:23
Methyl-2-deoxyribofuranose 3,5-dibenzoate structure
|
Common Name | Methyl-2-deoxyribofuranose 3,5-dibenzoate | ||
|---|---|---|---|---|
| CAS Number | 108647-88-7 | Molecular Weight | 356.369 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 479.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7±28.8 °C | |
| Name | 1-Methoxy-2-deoxy-3,5-di-O-benzoylribofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.369 |
| Flash Point | 209.7±28.8 °C |
| Exact Mass | 356.125977 |
| PSA | 71.06000 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | FKSXOZQTBMQUJG-MYFVLZFPSA-N |
| SMILES | COC1CC(OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)O1 |
| HS Code | 2932190090 |
|---|
|
~%
Methyl-2-deoxyr... CAS#:108647-88-7 |
| Literature: Journal of the American Chemical Society, , vol. 127, # 44 p. 15612 - 15617 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:51255-12-0| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Methyl-2-deoxy-D-erythropentofuranoside dibenzoate |
| D-erythro-Pentofuranoside, methyl 2-deoxy-, dibenzoate |
| Methyl-2-deoxyribofuranose 3,5-dibenzoate |
| Methyl 3,5-di-O-benzoyl-2-deoxy-D-erythro-pentofuranoside |