1-Acetyl-2-deoxy-3,5-di-O-benzoylribofuranose structure
|
Common Name | 1-Acetyl-2-deoxy-3,5-di-O-benzoylribofuranose | ||
|---|---|---|---|---|
| CAS Number | 51255-12-0 | Molecular Weight | 384.37900 | |
| Density | 1.3g/cm3 | Boiling Point | 504.9ºC at 760 mmHg | |
| Molecular Formula | C21H20O7 | Melting Point | 98-100ºC | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 1-Acetyl-2-deoxy-3,5-di-O-benzoylribofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 504.9ºC at 760 mmHg |
| Melting Point | 98-100ºC |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.37900 |
| Flash Point | 220.3ºC |
| Exact Mass | 384.12100 |
| PSA | 88.13000 |
| LogP | 2.74710 |
| Index of Refraction | 1.58 |
| InChIKey | OKAAPNNOKHRHLI-PAMZHZACSA-N |
| SMILES | CC(=O)OC1CC(OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)O1 |
| HS Code | 2932190090 |
|---|
|
~86%
1-Acetyl-2-deox... CAS#:51255-12-0 |
| Literature: Rubira, Maria-Jose; Perez-Perez, Maria-Jesus; Balzarini, Jan; Camarasa, Maria-Jose Synlett, 1998 , # 2 p. 177 - 179 |
|
~%
1-Acetyl-2-deox... CAS#:51255-12-0 |
| Literature: Baud; Chavis; Lucas; Imbach Tetrahedron Letters, 1990 , vol. 31, # 31 p. 4437 - 4440 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| D-erythro-Pentofuranose, 2-deoxy-, 1-acetate 3,5-dibenzoate |