1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-2H-pyridine-3,6-dione structure
|
Common Name | 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-2H-pyridine-3,6-dione | ||
|---|---|---|---|---|
| CAS Number | 108664-28-4 | Molecular Weight | 275.68700 | |
| Density | 1.373g/cm3 | Boiling Point | 509.8ºC at 760mmHg | |
| Molecular Formula | C14H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-2H-pyridine-3,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760mmHg |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.68700 |
| Flash Point | 262.1ºC |
| Exact Mass | 275.03500 |
| PSA | 54.45000 |
| LogP | 1.94180 |
| Vapour Pressure | 1.65E-10mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | NGUGNQUIXGZKPR-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(Cl)cc1)N1CC(=O)C=CC1=O |
|
~%
1-[3-(4-chlorop... CAS#:108664-28-4 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[3-(4-chlorop... CAS#:108664-28-4 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-Pyrazinedione,1-[1-(4-chlorobenzoyl)ethenyl]-1,6-dihydro |
| 1-[1-(4-CHLOROBENZOYL)VINYL]-1,6-DIHYDRO-2,5-PYRIDINEDIONE |
| 2,5-Pyridinedione,1-(1-(4-chlorobenzoyl)ethenyl)-1,6-dihydro |