3-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]pyrimidin-4-one structure
|
Common Name | 3-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 108664-29-5 | Molecular Weight | 260.67600 | |
| Density | 1.28g/cm3 | Boiling Point | 431ºC at 760mmHg | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 3-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 431ºC at 760mmHg |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.67600 |
| Flash Point | 214.5ºC |
| Exact Mass | 260.03500 |
| PSA | 51.96000 |
| LogP | 2.25030 |
| Vapour Pressure | 1.24E-07mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | FNKSZCYWCKCZBX-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(Cl)cc1)n1cnccc1=O |
|
~%
3-[3-(4-chlorop... CAS#:108664-29-5 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
3-[3-(4-chlorop... CAS#:108664-29-5 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-[1-(4-CHLOROBENZOYL)VINYL]-4(3H)-PYRIMIDINONE |
| 4(3H)-Pyrimidinone,3-[1-(4-chlorobenzoyl)ethenyl] |