3-[3-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]quinazolin-4-one structure
|
Common Name | 3-[3-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 108664-35-3 | Molecular Weight | 306.31500 | |
| Density | 1.21g/cm3 | Boiling Point | 518.4ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.3ºC | |
| Name | 3-[3-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 518.4ºC at 760 mmHg |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.31500 |
| Flash Point | 267.3ºC |
| Exact Mass | 306.10000 |
| PSA | 61.19000 |
| LogP | 2.75870 |
| Vapour Pressure | 7.5E-11mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | CSVYJUVUGZFMJT-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(OC)cc1)n1cnc2ccccc2c1=O |
|
~%
3-[3-(4-methoxy... CAS#:108664-35-3 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
3-[3-(4-methoxy... CAS#:108664-35-3 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4(3H)-Quinazolinone,3-(1-(4-methoxybenzoyl)ethenyl) |