1-phenyl-2-pyridin-4-ylprop-2-en-1-one structure
|
Common Name | 1-phenyl-2-pyridin-4-ylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 108664-37-5 | Molecular Weight | 209.24300 | |
| Density | 1.113g/cm3 | Boiling Point | 374ºC at 760mmHg | |
| Molecular Formula | C14H11NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | 1-phenyl-2-pyridin-4-ylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760mmHg |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.24300 |
| Flash Point | 187.4ºC |
| Exact Mass | 209.08400 |
| PSA | 29.96000 |
| LogP | 2.97770 |
| Vapour Pressure | 8.6E-06mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | LNKJTAXYOUBBSQ-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccccc1)c1ccncc1 |
|
~46%
1-phenyl-2-pyri... CAS#:108664-37-5 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-phenyl-2-pyri... CAS#:108664-37-5 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-PHENYL-2-(4-PYRIDINYL)-2-PROPEN-1-ONE |
| 2(1H)-Pyridinone,1-(1-benzoylethenyl)-5-chloro |
| 2-Propen-1-one,1-phenyl-2-(4-pyridinyl) |