2-benzyl-1-thiophen-3-ylprop-2-en-1-one structure
|
Common Name | 2-benzyl-1-thiophen-3-ylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 108664-49-9 | Molecular Weight | 228.30900 | |
| Density | 1.146g/cm3 | Boiling Point | 366.8ºC at 760 mmHg | |
| Molecular Formula | C14H12OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6ºC | |
| Name | 2-benzyl-1-thiophen-3-ylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 366.8ºC at 760 mmHg |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.30900 |
| Flash Point | 175.6ºC |
| Exact Mass | 228.06100 |
| PSA | 45.31000 |
| LogP | 3.72970 |
| Vapour Pressure | 1.43E-05mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | IPBKSFACAOIGOI-UHFFFAOYSA-N |
| SMILES | C=C(Cc1ccccc1)C(=O)c1ccsc1 |
|
~58%
2-benzyl-1-thio... CAS#:108664-49-9 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
2-benzyl-1-thio... CAS#:108664-49-9 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(2-thienyl)-2-benzyl-2-propen-1-one |
| 2-(PHENYLMETHYL)-1-(3-THIENYL)-2-PROPEN-1-ONE |
| 2-Propen-1-one,2-(phenylmethyl)-1-(3-thienyl) |