N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)prop-2-enamide structure
|
Common Name | N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 108664-50-2 | Molecular Weight | 326.60500 | |
| Density | 1.407g/cm3 | Boiling Point | 520.4ºC at 760mmHg | |
| Molecular Formula | C15H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.5ºC | |
| Name | N-(4-chlorophenyl)-2-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 520.4ºC at 760mmHg |
| Molecular Formula | C15H10Cl3NO |
| Molecular Weight | 326.60500 |
| Flash Point | 268.5ºC |
| Exact Mass | 324.98300 |
| PSA | 29.10000 |
| LogP | 5.37170 |
| Vapour Pressure | 6.25E-11mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | DDXPMQBMIYDZHW-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)Nc1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
|
~%
N-(4-chlorophen... CAS#:108664-50-2 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2,4-dichlorophenyl)-4'-chloroacrylanilide |
| Benzeneacetamide,2,4-dichloro-N-(4-chlorophenyl)-a-methylene |