1-(4-methoxyphenyl)-3-(1,2,4-triazol-1-yl)propan-1-one structure
|
Common Name | 1-(4-methoxyphenyl)-3-(1,2,4-triazol-1-yl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 108664-74-0 | Molecular Weight | 231.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-3-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N3O2 |
|---|---|
| Molecular Weight | 231.25100 |
| Exact Mass | 231.10100 |
| PSA | 57.01000 |
| LogP | 1.55970 |
| InChIKey | MGQQHBPLUHITEX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCn2cncn2)cc1 |
|
~%
1-(4-methoxyphe... CAS#:108664-74-0 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-(4-methoxyphe... CAS#:108664-74-0 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Propanone,1-(4-methoxyphenyl)-3-(1H-1,2,4-triazol-1-yl) |