4-(4-Methylphenoxy)phenylhydrazine hydrochloride structure
|
Common Name | 4-(4-Methylphenoxy)phenylhydrazine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 108902-83-6 | Molecular Weight | 250.72400 | |
| Density | N/A | Boiling Point | 364.6ºC at 760mmHg | |
| Molecular Formula | C13H15ClN2O | Melting Point | 198(dec.)ºC | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 4-(4-Methylphenoxy)phenylhydrazine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 364.6ºC at 760mmHg |
|---|---|
| Melting Point | 198(dec.)ºC |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.72400 |
| Flash Point | 174.3ºC |
| Exact Mass | 250.08700 |
| PSA | 47.28000 |
| LogP | 4.64820 |
| Vapour Pressure | 1.66E-05mmHg at 25°C |
| InChIKey | XKCVGENJIPOARL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(NN)cc2)cc1.Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| [4-(4-methylphenoxy)phenyl]hydrazine,hydrochloride |