confusarin structure
|
Common Name | confusarin | ||
|---|---|---|---|---|
| CAS Number | 108909-02-0 | Molecular Weight | 300.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of confusarinConfusarin (compound 12) is a phenanthrene compound that was isolated from F. fimbriata for the first time[1]. |
| Name | confusarin |
|---|---|
| Synonym | More Synonyms |
| Description | Confusarin (compound 12) is a phenanthrene compound that was isolated from F. fimbriata for the first time[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H16O5 |
|---|---|
| Molecular Weight | 300.30600 |
| Exact Mass | 300.10000 |
| PSA | 68.15000 |
| LogP | 3.43000 |
| InChIKey | JHNVCKNCEVZGGC-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2ccc3c(OC)c(O)ccc3c2c1OC |
| Hazard Codes | Xi |
|---|
| 1,5,6-Trimethoxy-phenanthrene-2,7-diol |
| 2,7-dihydroxy-3,4,8-trimethoxyphenanthrene |