Octanoic acid,1,4-butanediyl ester (9CI) structure
|
Common Name | Octanoic acid,1,4-butanediyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 109-41-1 | Molecular Weight | 342.51300 | |
| Density | 0.936g/cm3 | Boiling Point | 422.8ºC at 760mmHg | |
| Molecular Formula | C20H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 4-octanoyloxybutyl octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.936g/cm3 |
|---|---|
| Boiling Point | 422.8ºC at 760mmHg |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.51300 |
| Flash Point | 198ºC |
| Exact Mass | 342.27700 |
| PSA | 52.60000 |
| LogP | 5.57400 |
| Vapour Pressure | 2.34E-07mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | JYJAMZPYEGWUDM-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCCCOC(=O)CCCCCCC |
| HS Code | 2915900090 |
|---|
|
~%
Octanoic acid,1... CAS#:109-41-1 |
| Literature: Murai et al. J.Oil Chemists Soc.JapanChem.Abstr., 1954 , vol. 3, p. 2,5 J.Oil Chemists Soc.JapanChem.Abstr., 1956 , p. 250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| butane-1,4-diyl dioctanoate |
| Octanoic acid,4-butanediyl ester |
| butylene glycol dicaprylate |
| Octanoic acid,tetramethylene ester |
| 1,4-bis-octanoyloxy-butane |