2-[4-(Ethoxycarbonyl)phenyl]-6-methyl-imidazo[1,2-a]pyridine structure
|
Common Name | 2-[4-(Ethoxycarbonyl)phenyl]-6-methyl-imidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 109461-69-0 | Molecular Weight | 280.32100 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzoate |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32100 |
| Exact Mass | 280.12100 |
| PSA | 43.60000 |
| LogP | 3.48640 |
| Index of Refraction | 1.605 |
| InChIKey | JOQPDAAQTAOZFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(-c2cn3cc(C)ccc3n2)cc1 |
|
~88%
2-[4-(Ethoxycar... CAS#:109461-69-0 |
| Literature: Klupsch, Frederique; Houssin, Raymond; Humbert, Luc; Imbenotte, Michel; Henichart, Jean-Pierre; Lhermitte, Michel Chemical and Pharmaceutical Bulletin, 2006 , vol. 54, # 9 p. 1318 - 1321 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |