tris(phenylsulfanyl)phosphane structure
|
Common Name | tris(phenylsulfanyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 1095-04-1 | Molecular Weight | 358.48000 | |
| Density | N/A | Boiling Point | 503.5ºC at 760mmHg | |
| Molecular Formula | C18H15PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.3ºC | |
| Name | tris(phenylsulfanyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 503.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H15PS3 |
| Molecular Weight | 358.48000 |
| Flash Point | 258.3ºC |
| Exact Mass | 358.00700 |
| PSA | 89.49000 |
| LogP | 7.59020 |
| Vapour Pressure | 9.01E-10mmHg at 25°C |
| InChIKey | MRQLRZQLPODMPG-UHFFFAOYSA-N |
| SMILES | c1ccc(SP(Sc2ccccc2)Sc2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| triphenyl phosphorotrithioite |
| tris-(phenylthio)phosphite |
| Triphenyl trithiophosphite |
| EINECS 214-138-6 |
| Triphenyl phosphorothrithioite |
| triphenyl trithiophosphate |
| triphenyl phosphorotrithioites |