Prinomide tromethamine structure
|
Common Name | Prinomide tromethamine | ||
|---|---|---|---|---|
| CAS Number | 109636-76-2 | Molecular Weight | 404.41700 | |
| Density | N/A | Boiling Point | 837.5ºC at 760 mmHg | |
| Molecular Formula | C19H24N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 460.3ºC | |
Use of Prinomide tromethaminePrinomide tromethamine is an orally available nonsteroidal anti-inflammatory agent. Prinomide tromethamine can be used to study inflammation, such as rheumatoid arthritis[1][2]. |
| Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol,2-cyano-3-(1-methylpyrrol-2-yl)-3-oxo-N-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Prinomide tromethamine is an orally available nonsteroidal anti-inflammatory agent. Prinomide tromethamine can be used to study inflammation, such as rheumatoid arthritis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 837.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.41700 |
| Flash Point | 460.3ºC |
| Exact Mass | 404.17000 |
| PSA | 181.83000 |
| LogP | 0.12598 |
| Vapour Pressure | 9.15E-30mmHg at 25°C |
| InChIKey | CPUJDORGQAJDCT-UHFFFAOYSA-N |
| SMILES | Cn1cccc1C(=O)C(C#N)C(=O)Nc1ccccc1.NC(CO)(CO)CO |
| Prinomide tromethamine (USAN) |
| PRINOMIDE TROMETHAMINE |
| UNII-33S1GFG04E |