4-(4-ethylphenoxy)benzene-1,2-dicarbonitrile structure
|
Common Name | 4-(4-ethylphenoxy)benzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 109702-53-6 | Molecular Weight | 248.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-ethylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O |
|---|---|
| Molecular Weight | 248.27900 |
| Exact Mass | 248.09500 |
| PSA | 56.81000 |
| LogP | 3.78466 |
| InChIKey | NCESTMIXNQOCRN-UHFFFAOYSA-N |
| SMILES | CCc1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
|
~65%
4-(4-ethylpheno... CAS#:109702-53-6 |
| Literature: Shankar, Rama; Sharma, Pankaj; Cabrera; Espinosa; Rosas, Noe; Jha; Vasudevan Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1996 , vol. 35, # 9 p. 894 - 899 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(p-ethylphenoxy)phthalonitrile |
| 1,2-Benzenedicarbonitrile,4-(4-ethylphenoxy) |
| 4-(4-ethylphenoxy)phthalonitrile |