Neldazosin structure
|
Common Name | Neldazosin | ||
|---|---|---|---|---|
| CAS Number | 109713-79-3 | Molecular Weight | 375.42200 | |
| Density | 1.313g/cm3 | Boiling Point | 659.8ºC at 760mmHg | |
| Molecular Formula | C18H25N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.8ºC | |
Use of NeldazosinNeldazosin is a potent alpha1-adrenoceptor antagonist[1]. |
| Name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-hydroxybutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Neldazosin is a potent alpha1-adrenoceptor antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 659.8ºC at 760mmHg |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.42200 |
| Flash Point | 352.8ºC |
| Exact Mass | 375.19100 |
| PSA | 114.77000 |
| LogP | 0.58170 |
| Vapour Pressure | 2.61E-18mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | IOSMPEJNAQZKJT-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(N3CCN(C(=O)CC(C)O)CC3)nc(N)c2cc1OC |
| 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(3-hydroxy-1-oxobutyl)piperazine |
| Neldazosina [INN-Spanish] |
| HRO 2/145 |
| Neldazosine [INN-French] |
| Neldazosinum [INN-Latin] |
| Neldazosin |
| Neldazosin [INN] |
| 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(3-hydroxybutyryl)piperazine |