GS-9451
Modify Date: 2025-09-12 12:51:26
GS-9451 structure
|
Common Name | GS-9451 | ||
|---|---|---|---|---|
| CAS Number | 1098189-15-1 | Molecular Weight | 910.51700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H60ClN7O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GS-9451GS-9451 (Vedroprevir) is a potent HCV NS3/4A protease inhibitor with Ki of 0.41 nM, inhibits HCV GT-1b NS3/4A with IC50 of 3.2 nM in enzymatic assays. |
| Name | gs-9451 |
|---|
| Molecular Formula | C45H60ClN7O9S |
|---|---|
| Molecular Weight | 910.51700 |
| Exact Mass | 909.38600 |
| PSA | 222.02000 |
| LogP | 6.93080 |
| InChIKey | OTXAMWFYPMNDME-OPUYQWCOSA-N |
| SMILES | CCC1CC1(NC(=O)C1CC(Oc2cc(-c3csc(NC(C)C)n3)nc3c(Cl)c(OCCN4CCOCC4)ccc23)CN1C(=O)C(NC(=O)OC1CC2CC2C1)C(C)(C)C)C(=O)O |