O-Butanoyl-3 di-O-isopropylidene-1,2:5,6 alpha-D-glucofurannose [Frenc h] structure
|
Common Name | O-Butanoyl-3 di-O-isopropylidene-1,2:5,6 alpha-D-glucofurannose [Frenc h] | ||
|---|---|---|---|---|
| CAS Number | 109984-82-9 | Molecular Weight | 330.37300 | |
| Density | 1.2g/cm3 | Boiling Point | 380.4ºC at 760mmHg | |
| Molecular Formula | C16H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.9ºC | |
| Name | [(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] butanoate |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 380.4ºC at 760mmHg |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.37300 |
| Flash Point | 163.9ºC |
| Exact Mass | 330.16800 |
| PSA | 72.45000 |
| LogP | 1.72620 |
| Vapour Pressure | 5.48E-06mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | NJJNAEMZQBLYRV-KSDCKGNFSA-N |
| SMILES | CCCC(=O)OC1C(C2COC(C)(C)O2)OC2OC(C)(C)OC21 |
|
~%
O-Butanoyl-3 di... CAS#:109984-82-9 |
| Literature: Wolff Journal of the American Chemical Society, 1945 , vol. 67, p. 1623 |
|
~92%
O-Butanoyl-3 di... CAS#:109984-82-9 |
| Literature: Goueth, Pierre Y.; Gogalis, Pascalis; Bikanga, Raphael; Gode, Paul; Postel, Denis; et al. Journal of Carbohydrate Chemistry, 1994 , vol. 13, # 2 p. 249 - 272 |