bacoside a structure
|
Common Name | bacoside a | ||
|---|---|---|---|---|
| CAS Number | 11028-00-5 | Molecular Weight | 768.971 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 882.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C41H68O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5±27.8 °C | |
Use of bacoside aBacoside A exhibits hepatoprotective activity[1]. |
| Name | 3-[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-10-(hydroxymethyl)-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,14-tetramethyl-1,2,3,5,6,7,9,11,12,13,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| Synonym | More Synonyms |
| Description | Bacoside A exhibits hepatoprotective activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 882.3±65.0 °C at 760 mmHg |
| Molecular Formula | C41H68O13 |
| Molecular Weight | 768.971 |
| Flash Point | 259.5±27.8 °C |
| Exact Mass | 768.466003 |
| PSA | 215.83000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | LKCTWIIDXXXXAR-CYGHALRTSA-N |
| SMILES | CC(C)=CCCC(C)(O)C1C(=O)CC2(C)C1CCC1C3(CO)CCC(OC4OC(CO)C(OC5OCC(O)C(O)C5O)C(O)C4O)C(C)(C)C3CCC12C |
| Storage condition | 2-8°C |
| 19,20-Dihydroxy-16-oxodammar-24-en-3-yl 4-O-α-L-arabinopyranosyl-β-D-glucopyranoside |
| Bacoside A |
| Bacoside B |