Meso-Tetra(4-tert-butylphenyl) Porphine structure
|
Common Name | Meso-Tetra(4-tert-butylphenyl) Porphine | ||
|---|---|---|---|---|
| CAS Number | 110452-48-7 | Molecular Weight | 839.16 | |
| Density | 1.108g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C60H62N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Meso-Tetra(4-tert-butylphenyl) Porphinemeso-Tetra(4-tert-butylphenyl) porphine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 5,10,15,20-Tetrakis[4-(2-methyl-2-propanyl)phenyl]porphyri |
|---|---|
| Synonym | More Synonyms |
| Description | meso-Tetra(4-tert-butylphenyl) porphine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.108g/cm3 |
|---|---|
| Molecular Formula | C60H62N4 |
| Molecular Weight | 839.16 |
| Exact Mass | 838.49700 |
| PSA | 56.30000 |
| LogP | 12.05620 |
| Index of Refraction | 1.61 |
| InChIKey | TUYJGWWPMWEZSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| Hazard Codes | Xi |
|---|
|
~57%
Meso-Tetra(4-te... CAS#:110452-48-7 |
| Literature: Liu, Mark O.; Tai, Chia-Hon; Wang, Wei-Ya; Chen, Jun-Rong; Hu, Andrew Teh; Wei, Tai-Huei Journal of Organometallic Chemistry, 2004 , vol. 689, # 6 p. 1078 - 1084 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,10,15,20-tetrakis(4-tert-butylphenyl)porphyrin |
| tetrakis(p-sulfonylphenyl)porphyrin tetra-anion |
| 5,10,15,20-tetrakis(4-sulfonatophenyl)-21H,23H-porphine |
| 5,10,15,20-tetrakis(p-tert-butylphenyl)porphyrin |
| meso-tetrakis(4-tert-butylphenyl)porphyrin |
| 5,10,15,20-tetrakis(4-sulfonatophenyl)porphyrin |
| TETRASODIUM-meso-TETRA(4-SULFONATOPHENYL) PORPHINE |
| 4-tert-Bu-TPP |
| free base 5,10,15,20-tetrakis-(4-sulfonatophenyl)-porphine |
| 5,10,15,20-tetra(4-tert-butyl-phenyl)porphyrin |
| Tetrasodium-meso-tetra(4-sulfonatophenyl)porphinedodecahydrate |