6-BROMO-3-PHENYL-2-QUINOLINOL
Modify Date: 2025-09-16 20:38:11
6-BROMO-3-PHENYL-2-QUINOLINOL structure
|
Common Name | 6-BROMO-3-PHENYL-2-QUINOLINOL | ||
|---|---|---|---|---|
| CAS Number | 110486-57-2 | Molecular Weight | 300.15000 | |
| Density | 1.526g/cm3 | Boiling Point | 465.7ºC at 760 mmHg | |
| Molecular Formula | C15H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | 6-bromo-3-phenyl-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 465.7ºC at 760 mmHg |
| Molecular Formula | C15H10BrNO |
| Molecular Weight | 300.15000 |
| Flash Point | 235.5ºC |
| Exact Mass | 298.99500 |
| PSA | 33.12000 |
| LogP | 4.36990 |
| Vapour Pressure | 2.7E-09mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | UWAZVSRZYPQWHU-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccc(Br)cc2cc1-c1ccccc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-3-phenyl-2-quinolinol |
| 2(1H)-Quinolinone,6-bromo-3-phenyl |
| 6-Bromo-2-hydroxy-3-phenylquinoline |